(-)-Di-O-acetyl-L-tartaric acid - Names and Identifiers
Name | Diacetyltartaricacid
|
Synonyms | Diacetyltartaricacid (R,R)-DIACETYLTARTARIC ACID (-)-DIACETYL-L-TARTARIC ACID (-)-Diacetyl-L-tartaric acid (-)-Di-O-acetyl-L-tartaric acid (+)-L-Tartaric acid 2,3-diacetate 2,3-bis(acetyloxy)butanedioic acid (-)-2-O,3-O-Diacetyl-L-tartaric acid [R(R*,R*)]-2,3-bis(acetoxy)succinic acid (2R,3R)-2,3-bis(acetyloxy)butanedioic acid
|
CAS | 51591-38-9
|
EINECS | 257-303-8 |
InChI | InChI=1/C8H10O8/c1-3(9)15-5(7(11)12)6(8(13)14)16-4(2)10/h5-6H,1-2H3,(H,11,12)(H,13,14)/t5-,6-/m1/s1 |
(-)-Di-O-acetyl-L-tartaric acid - Physico-chemical Properties
Molecular Formula | C8H10O8
|
Molar Mass | 234.16 |
Density | 1.486±0.06 g/cm3(Predicted) |
Melting Point | 120°C |
Boling Point | 398.9±42.0 °C(Predicted) |
Flash Point | 159.4°C |
Solubility | almost transparency in Acetone |
Vapor Presure | 1.77E-07mmHg at 25°C |
Appearance | powder to crystal |
Color | White to Almost white |
pKa | 2.12±0.25(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | -25 ° (C=10, Acetone |
(-)-Di-O-acetyl-L-tartaric acid - Risk and Safety
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
|
(-)-Di-O-acetyl-L-tartaric acid - Introduction
Diacetyltartaricacid(Diacetyltartaric acid) is an organic compound with the chemical formula C8H12O7. Its properties are as follows:
1. appearance and properties: the Diacetyltartaricacid is white crystalline powder or crystal, with a special sour taste.
2. solubility: Diacetyltartaricacid can be dissolved in water, but also soluble in alcohol and ether solvents.
3. Chemical properties: Diacetyltartaricacid is a diketo acid with two ketone groups and two carboxyl groups. It is a weak acid that produces an acidic reaction in aqueous solution.
The main uses of Diacetyltartaricacid are as follows:
1. Food industry: Diacetyltartaricacid can be used as food acidity regulator and stabilizer to improve the taste and texture of food, and increase the freshness and oxidation resistance of food.
2. pharmaceutical industry: Diacetyltartaricacid can be used to prepare certain drugs, such as lactic acid bacteria preparations and yeast preparations.
There are two main methods for preparing Diacetyltartaricacid:
1. extracted from natural tartaric acid.
2. through chemical synthesis, the reaction of tartaric acid and acetic anhydride.
Regarding the safety information of Diacetyltartaricacid, the current research shows that it is a safer chemical, but the following matters still need to be paid attention:
1. use to comply with the relevant safety procedures, such as wearing protective gloves and glasses.
2. avoid contact with skin or eyes, such as accidental contact, please rinse with plenty of water.
3. storage should be sealed, in a dry, cool place, away from the fire and oxidant.
4. comply with regulations to prevent misuse or unauthorized exposure.
Last Update:2024-04-09 21:54:55